The chelate effect can be partially explained in terms of the entropy change involved in chelation reactions. the reaction forming coedta? from the hexaaqua complex of co3+,co(h2o)63+(aq) + edta4-(aq) ? coedta-(aq)+ 6h2o(l)leads to a net increase in the number of particles in the solution. part a: in which of the following reactions will the entropy change, ? s, be a positive value? a. caedta? (aq)+3en(aq)? ca(en)33(aq)+edta4? (aq)b. cu(h2o)62+(aq)+3nh3(aq)? cu(h2o)3(nh3)32+(aq)+3h2o(l)c. co(nh3)4(acac)3+(aq)+2acac(aq)? co(acac)33+(aq)+3nh3(aq)d. zncl2(en)(aq)+4oh? (aq)? zn(oh)2? 4(aq)+2cl? (aq)+en(aq)e. fecl64? (aq)+edta4? (aq)? feedta2? (aq)+6cl? (aq)

Lab reagent, hypothesis test. a reference solution used as a lab reagent is purported to have a concentration of 5 mg/dl. six samples are taken from this solution and the following concentrations are recorded: (5.32, 4.88, 5.10, 4.73, 5.15, 4.75) mg/dl. these six measurements are assumed to be an srs of all possible measurements from solution. they are also assumed to have a standard deviation of 0.2, a normal distributin, and a mean concentration equal to the true concentration of the solution. carry out a significance test to determine whether these six measurements provide reliable evidence that the true concentration of the solution is actually not 5 mg/dl.

Ahypothesis must be testable and falsifiable to be considered scientific a. trueb. false

The sum of the oxidation numbers in a neutral compound is always