Does anyone knows the skeletal structure for this one?

CH3-CH(CH3)-CH2-CH2-CH2-C(CH3)2-CH(CH3)-CH3

it's named

2,3,3,7-tertamethyloctane

the correct answer would be 6 feet.

step 1: nitrogen fixation- conversion of atmospheric no₂ into forms useful to plants by lightning, bacteria, and cyanobacteria.

step 2: nitrification-process of converting ammonia to nitrite or nitrate.

step 3: assimilation-plant roots absorb new form of nitrogen.

step 4: ammonification-conversion of organic nitrogen to ammonia by bacteria involved in decomposition.

step 5: denitrification-bacteria turns the decomposed matter back into n₂o, which is released into atmosphere; repeat cycle.